C14H13N3O2S2 — CID 168707351
S-[5-oxo-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168707351) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is S-[5-oxo-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707351 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | S-[5-oxo-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2nc(-c3ccncc3)cs2)C1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-9(18)21-11-6-13(19)17(7-11)14-16-12(8-20-14)10-2-4-15-5-3-10/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | XWKVWZDTGKRAAA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|