C10H11N3O2S — CID 168707325
S-(5-oxo-1-pyrimidin-5-ylpyrrolidin-3-yl) ethanethioate (PubChem CID 168707325) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is S-(5-oxo-1-pyrimidin-5-ylpyrrolidin-3-yl) ethanethioate.
| Compound Name | S-(5-oxo-1-pyrimidin-5-ylpyrrolidin-3-yl) ethanethioate |
|---|---|
| PubChem CID | 168707325 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | S-(5-oxo-1-pyrimidin-5-ylpyrrolidin-3-yl) ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cncnc2)C1 |
| InChI | InChI=1S/C10H11N3O2S/c1-7(14)16-9-2-10(15)13(5-9)8-3-11-6-12-4-8/h3-4,6,9H,2,5H2,1H3 |
| InChIKey | JRKUETAYJOVSRI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|