C11H10Cl2N2O2S — CID 168707114
S-[1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707114) has the molecular formula C11H10Cl2N2O2S and a molecular weight of 305.19 g/mol. Its IUPAC name is S-[1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707114 |
| Molecular Formula | C11H10Cl2N2O2S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | S-[1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(Cl)nc(Cl)c2)C1 |
| InChI | InChI=1S/C11H10Cl2N2O2S/c1-6(16)18-8-4-11(17)15(5-8)7-2-9(12)14-10(13)3-7/h2-3,8H,4-5H2,1H3 |
| InChIKey | PWVVIPWWGJQPKC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|