C9H8Cl2N2O2 — CID 168703824
1-(2,6-dichloro-4-pyridinyl)-4-hydroxypyrrolidin-2-one (PubChem CID 168703824) has the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.08 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168703824 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O2/c10-7-1-5(2-8(11)12-7)13-4-6(14)3-9(13)15/h1-2,6,14H,3-4H2 |
| InChIKey | VTYTWWCVTDOETR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|