C10H8BrF2NO2 — CID 168703474
1-(4-bromo-3,5-difluorophenyl)-4-hydroxypyrrolidin-2-one (PubChem CID 168703474) has the molecular formula C10H8BrF2NO2 and a molecular weight of 292.08 g/mol. Its IUPAC name is 1-(4-bromo-3,5-difluorophenyl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(4-bromo-3,5-difluorophenyl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168703474 |
| Molecular Formula | C10H8BrF2NO2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 1-(4-bromo-3,5-difluorophenyl)-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C10H8BrF2NO2/c11-10-7(12)1-5(2-8(10)13)14-4-6(15)3-9(14)16/h1-2,6,15H,3-4H2 |
| InChIKey | ZEOHVTPLDAGWKL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|