C10H8ClF2NO2 — CID 83087452
1-(2-chloro-4,6-difluorophenyl)-4-hydroxypyrrolidin-2-one (PubChem CID 83087452) has the molecular formula C10H8ClF2NO2 and a molecular weight of 247.63 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 83087452 |
| Molecular Formula | C10H8ClF2NO2 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H8ClF2NO2/c11-7-1-5(12)2-8(13)10(7)14-4-6(15)3-9(14)16/h1-2,6,15H,3-4H2 |
| InChIKey | MEMKPRLSHZNTGS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |