C11H8ClF2NO5S — CID 168715157
3-chloro-5-fluoro-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)benzoic acid (PubChem CID 168715157) has the molecular formula C11H8ClF2NO5S and a molecular weight of 339.70 g/mol. Its IUPAC name is 3-chloro-5-fluoro-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)benzoic acid.
| Compound Name | 3-chloro-5-fluoro-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168715157 |
| Molecular Formula | C11H8ClF2NO5S |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 3-chloro-5-fluoro-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(Cl)c1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H8ClF2NO5S/c12-8-2-5(13)1-7(11(17)18)10(8)15-4-6(3-9(15)16)21(14,19)20/h1-2,6H,3-4H2,(H,17,18) |
| InChIKey | AROZSCYGELOHIY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |