C10H8ClF2NO4S — CID 168715207
1-(4-chloro-2-fluoro-5-hydroxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715207) has the molecular formula C10H8ClF2NO4S and a molecular weight of 311.69 g/mol. Its IUPAC name is 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715207 |
| Molecular Formula | C10H8ClF2NO4S |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 1-(4-chloro-2-fluoro-5-hydroxyphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1cc(O)c(Cl)cc1F |
| InChI | InChI=1S/C10H8ClF2NO4S/c11-6-2-7(12)8(3-9(6)15)14-4-5(1-10(14)16)19(13,17)18/h2-3,5,15H,1,4H2 |
| InChIKey | ZNUJXUUEWABBGC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |