C10H7Cl2F2NO3S — CID 168715214
1-(3,4-dichloro-2-fluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715214) has the molecular formula C10H7Cl2F2NO3S and a molecular weight of 330.14 g/mol. Its IUPAC name is 1-(3,4-dichloro-2-fluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(3,4-dichloro-2-fluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715214 |
| Molecular Formula | C10H7Cl2F2NO3S |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 1-(3,4-dichloro-2-fluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ccc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C10H7Cl2F2NO3S/c11-6-1-2-7(10(13)9(6)12)15-4-5(3-8(15)16)19(14,17)18/h1-2,5H,3-4H2 |
| InChIKey | KRVCZYIDBOFZCC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|