C11H10Cl2FNO2 — CID 168663351
1-(3,4-dichloro-2-fluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663351) has the molecular formula C11H10Cl2FNO2 and a molecular weight of 278.11 g/mol. Its IUPAC name is 1-(3,4-dichloro-2-fluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(3,4-dichloro-2-fluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663351 |
| Molecular Formula | C11H10Cl2FNO2 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 1-(3,4-dichloro-2-fluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CO)CN1c1ccc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C11H10Cl2FNO2/c12-7-1-2-8(11(14)10(7)13)15-4-6(5-16)3-9(15)17/h1-2,6,16H,3-5H2 |
| InChIKey | LJWRFMRWKFZGCV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|