C12H13BrClNO2 — CID 168662547
1-(4-bromo-3-chloro-2-methylphenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168662547) has the molecular formula C12H13BrClNO2 and a molecular weight of 318.60 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-methylphenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-bromo-3-chloro-2-methylphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168662547 |
| Molecular Formula | C12H13BrClNO2 |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-methylphenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | Cc1c(N2CC(CO)CC2=O)ccc(Br)c1Cl |
| InChI | InChI=1S/C12H13BrClNO2/c1-7-10(3-2-9(13)12(7)14)15-5-8(6-16)4-11(15)17/h2-3,8,16H,4-6H2,1H3 |
| InChIKey | AKPDUFSBFSNEKK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |