C13H13BrClNO2 — CID 132593404
1-(4-bromo-2,3-dimethylphenyl)-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 132593404) has the molecular formula C13H13BrClNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dimethylphenyl)-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | 1-(4-bromo-2,3-dimethylphenyl)-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 132593404 |
| Molecular Formula | C13H13BrClNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 1-(4-bromo-2,3-dimethylphenyl)-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | Cc1c(Br)ccc(N2CC(C(=O)Cl)CC2=O)c1C |
| InChI | InChI=1S/C13H13BrClNO2/c1-7-8(2)11(4-3-10(7)14)16-6-9(13(15)18)5-12(16)17/h3-4,9H,5-6H2,1-2H3 |
| InChIKey | PAJUVLNUSXACNY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|