C12H15NO4S — CID 168662518
4-(hydroxymethyl)-1-(2-methylsulfonylphenyl)pyrrolidin-2-one (PubChem CID 168662518) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-(2-methylsulfonylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(hydroxymethyl)-1-(2-methylsulfonylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168662518 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-(hydroxymethyl)-1-(2-methylsulfonylphenyl)pyrrolidin-2-one |
| SMILES | CS(=O)(=O)c1ccccc1N1CC(CO)CC1=O |
| InChI | InChI=1S/C12H15NO4S/c1-18(16,17)11-5-3-2-4-10(11)13-7-9(8-14)6-12(13)15/h2-5,9,14H,6-8H2,1H3 |
| InChIKey | GNPFGRZKMBAXKA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |