C12H14N2O4S — CID 168696654
1-(2-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168696654) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 1-(2-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168696654 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(2-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1N1CC(C(N)=O)CC1=O |
| InChI | InChI=1S/C12H14N2O4S/c1-19(17,18)10-5-3-2-4-9(10)14-7-8(12(13)16)6-11(14)15/h2-5,8H,6-7H2,1H3,(H2,13,16) |
| InChIKey | HRQTZBXFXRAYAE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |