C13H12N2O4 — CID 168698429
5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidine-3-carboxamide (PubChem CID 168698429) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698429 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cccc3c2COC3=O)C1 |
| InChI | InChI=1S/C13H12N2O4/c14-12(17)7-4-11(16)15(5-7)10-3-1-2-8-9(10)6-19-13(8)18/h1-3,7H,4-6H2,(H2,14,17) |
| InChIKey | HGPYAZICYAZWLM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |