C13H14N2O5S — CID 168683193
[5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683193) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is [5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683193 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | [5-oxo-1-(1-oxo-3H-2-benzofuran-4-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cccc3c2COC3=O)C1 |
| InChI | InChI=1S/C13H14N2O5S/c14-21(18,19)7-8-4-12(16)15(5-8)11-3-1-2-9-10(11)6-20-13(9)17/h1-3,8H,4-7H2,(H2,14,18,19) |
| InChIKey | OTCJUQHZZNOXHP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |