C13H14ClNO3 — CID 168662051
1-(5-acetyl-2-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168662051) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 1-(5-acetyl-2-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-acetyl-2-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168662051 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-(5-acetyl-2-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | CC(=O)c1ccc(Cl)c(N2CC(CO)CC2=O)c1 |
| InChI | InChI=1S/C13H14ClNO3/c1-8(17)10-2-3-11(14)12(5-10)15-6-9(7-16)4-13(15)18/h2-3,5,9,16H,4,6-7H2,1H3 |
| InChIKey | BWKTYWCGMXIEEA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |