C11H8ClF4NO3S — CID 168716062
1-[3-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168716062) has the molecular formula C11H8ClF4NO3S and a molecular weight of 345.70 g/mol. Its IUPAC name is 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168716062 |
| Molecular Formula | C11H8ClF4NO3S |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1cccc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H8ClF4NO3S/c12-7-2-1-3-8(10(7)11(13,14)15)17-5-6(4-9(17)18)21(16,19)20/h1-3,6H,4-5H2 |
| InChIKey | DUPRYNLUKXIOMQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |