C11H11Cl2NO3S — CID 168711657
1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711657) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711657 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | Cc1c(Cl)cccc1N1CC(S(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C11H11Cl2NO3S/c1-7-9(12)3-2-4-10(7)14-6-8(5-11(14)15)18(13,16)17/h2-4,8H,5-6H2,1H3 |
| InChIKey | JJOLZEQPLHPNOI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |