C11H11BrClNO3S — CID 168711701
1-(2-bromo-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711701) has the molecular formula C11H11BrClNO3S and a molecular weight of 352.64 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(2-bromo-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711701 |
| Molecular Formula | C11H11BrClNO3S |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | Cc1ccc(N2CC(S(=O)(=O)Cl)CC2=O)c(Br)c1 |
| InChI | InChI=1S/C11H11BrClNO3S/c1-7-2-3-10(9(12)4-7)14-6-8(5-11(14)15)18(13,16)17/h2-4,8H,5-6H2,1H3 |
| InChIKey | UGRQPWKEQVCAFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |