C10H10BrClN2O3S — CID 168711783
1-(5-bromo-6-methyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711783) has the molecular formula C10H10BrClN2O3S and a molecular weight of 353.63 g/mol. Its IUPAC name is 1-(5-bromo-6-methyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(5-bromo-6-methyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711783 |
| Molecular Formula | C10H10BrClN2O3S |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 1-(5-bromo-6-methyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | Cc1nc(N2CC(S(=O)(=O)Cl)CC2=O)ccc1Br |
| InChI | InChI=1S/C10H10BrClN2O3S/c1-6-8(11)2-3-9(13-6)14-5-7(4-10(14)15)18(12,16)17/h2-3,7H,4-5H2,1H3 |
| InChIKey | QGMOGOUWQNPCPD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |