C9H10ClN3O4S — CID 168711498
1-(6-methoxypyridazin-3-yl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711498) has the molecular formula C9H10ClN3O4S and a molecular weight of 291.72 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711498 |
| Molecular Formula | C9H10ClN3O4S |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | COc1ccc(N2CC(S(=O)(=O)Cl)CC2=O)nn1 |
| InChI | InChI=1S/C9H10ClN3O4S/c1-17-8-3-2-7(11-12-8)13-5-6(4-9(13)14)18(10,15)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | BQBHMAJDGLHLKB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |