C11H8BrClF3NO3S — CID 168712545
1-[2-bromo-4-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712545) has the molecular formula C11H8BrClF3NO3S and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[2-bromo-4-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712545 |
| Molecular Formula | C11H8BrClF3NO3S |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1c1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H8BrClF3NO3S/c12-8-3-6(11(14,15)16)1-2-9(8)17-5-7(4-10(17)18)21(13,19)20/h1-3,7H,4-5H2 |
| InChIKey | CNPFKNCCJQQKJC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |