C12H11F4NO3S — CID 168714471
1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714471) has the molecular formula C12H11F4NO3S and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714471 |
| Molecular Formula | C12H11F4NO3S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1c(N2CC(S(=O)(=O)F)CC2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F4NO3S/c1-7-9(12(13,14)15)3-2-4-10(7)17-6-8(5-11(17)18)21(16,19)20/h2-4,8H,5-6H2,1H3 |
| InChIKey | BXCNRGBBHWQCKL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |