C12H12F3NOS — CID 168708962
1-[2-methyl-3-(trifluoromethyl)phenyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168708962) has the molecular formula C12H12F3NOS and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-[2-methyl-3-(trifluoromethyl)phenyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-methyl-3-(trifluoromethyl)phenyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168708962 |
| Molecular Formula | C12H12F3NOS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-[2-methyl-3-(trifluoromethyl)phenyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1c(N2CC(S)CC2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NOS/c1-7-9(12(13,14)15)3-2-4-10(7)16-6-8(18)5-11(16)17/h2-4,8,18H,5-6H2,1H3 |
| InChIKey | WZOZHZMZQOQXOA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|