C13H13ClF3NO3S — CID 168673398
[1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673398) has the molecular formula C13H13ClF3NO3S and a molecular weight of 355.77 g/mol. Its IUPAC name is [1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673398 |
| Molecular Formula | C13H13ClF3NO3S |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | [1-[2-methyl-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | Cc1c(N2CC(CS(=O)(=O)Cl)CC2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C13H13ClF3NO3S/c1-8-10(13(15,16)17)3-2-4-11(8)18-6-9(5-12(18)19)7-22(14,20)21/h2-4,9H,5-7H2,1H3 |
| InChIKey | SCUUBZJSXKFWDI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |