C12H10ClF4NO3S — CID 168674206
[1-[2-fluoro-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674206) has the molecular formula C12H10ClF4NO3S and a molecular weight of 359.73 g/mol. Its IUPAC name is [1-[2-fluoro-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[2-fluoro-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674206 |
| Molecular Formula | C12H10ClF4NO3S |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | [1-[2-fluoro-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H10ClF4NO3S/c13-22(20,21)6-7-4-10(19)18(5-7)9-3-1-2-8(11(9)14)12(15,16)17/h1-3,7H,4-6H2 |
| InChIKey | GDFCMPOALBFLLL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |