C12H12F4N2O3S — CID 168682229
[1-[2-fluoro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682229) has the molecular formula C12H12F4N2O3S and a molecular weight of 340.30 g/mol. Its IUPAC name is [1-[2-fluoro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[2-fluoro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682229 |
| Molecular Formula | C12H12F4N2O3S |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [1-[2-fluoro-6-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2c(F)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12F4N2O3S/c13-9-3-1-2-8(12(14,15)16)11(9)18-5-7(4-10(18)19)6-22(17,20)21/h1-3,7H,4-6H2,(H2,17,20,21) |
| InChIKey | VPVQMGFDHVZCMO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |