C13H15F3N2O3S — CID 168682107
[5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682107) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is [5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682107 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)11-4-2-1-3-10(11)7-18-6-9(5-12(18)19)8-22(17,20)21/h1-4,9H,5-8H2,(H2,17,20,21) |
| InChIKey | OTDYTRWUMKFGTC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |