C17H25N3O5S — CID 168680586
tert-butyl N-[2-[[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]methyl]phenyl]carbamate (PubChem CID 168680586) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 168680586 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | tert-butyl N-[2-[[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CN1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C17H25N3O5S/c1-17(2,3)25-16(22)19-14-7-5-4-6-13(14)10-20-9-12(8-15(20)21)11-26(18,23)24/h4-7,12H,8-11H2,1-3H3,(H,19,22)(H2,18,23,24) |
| InChIKey | ZOLZZPPTHMWFKT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |