C17H23FN2O5S — CID 168675104
tert-butyl N-[4-[[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]methyl]phenyl]carbamate (PubChem CID 168675104) has the molecular formula C17H23FN2O5S and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 168675104 |
| Molecular Formula | C17H23FN2O5S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | tert-butyl N-[4-[[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CN2CC(CS(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C17H23FN2O5S/c1-17(2,3)25-16(22)19-14-6-4-12(5-7-14)9-20-10-13(8-15(20)21)11-26(18,23)24/h4-7,13H,8-11H2,1-3H3,(H,19,22) |
| InChIKey | NWRXLKGHGWHMMC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |