C14H25FN2O5S — CID 168674722
tert-butyl N-[3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropyl]carbamate (PubChem CID 168674722) has the molecular formula C14H25FN2O5S and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 168674722 |
| Molecular Formula | C14H25FN2O5S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl N-[3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-2-methylpropyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)CN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C14H25FN2O5S/c1-10(6-16-13(19)22-14(2,3)4)7-17-8-11(5-12(17)18)9-23(15,20)21/h10-11H,5-9H2,1-4H3,(H,16,19) |
| InChIKey | WFYFULPDXCMZSF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |