C10H19FN2O4S — CID 168674730
[1-[2-(2-hydroxypropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674730) has the molecular formula C10H19FN2O4S and a molecular weight of 282.34 g/mol. Its IUPAC name is [1-[2-(2-hydroxypropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-(2-hydroxypropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674730 |
| Molecular Formula | C10H19FN2O4S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [1-[2-(2-hydroxypropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(O)CNCCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H19FN2O4S/c1-8(14)5-12-2-3-13-6-9(4-10(13)15)7-18(11,16)17/h8-9,12,14H,2-7H2,1H3 |
| InChIKey | OWPGIOMNMYRCSW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|