C8H14FNO3S — CID 168675162
(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride (PubChem CID 168675162) has the molecular formula C8H14FNO3S and a molecular weight of 223.27 g/mol. Its IUPAC name is (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride.
| Compound Name | (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675162 |
| Molecular Formula | C8H14FNO3S |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
| SMILES | CC(C)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C8H14FNO3S/c1-6(2)10-4-7(3-8(10)11)5-14(9,12)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | ASRBCEGBODYBNX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |