C17H24FNO3S — CID 168674714
[1-(4-methyl-4-phenylpentan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674714) has the molecular formula C17H24FNO3S and a molecular weight of 341.45 g/mol. Its IUPAC name is [1-(4-methyl-4-phenylpentan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-methyl-4-phenylpentan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674714 |
| Molecular Formula | C17H24FNO3S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [1-(4-methyl-4-phenylpentan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(CC(C)(C)c1ccccc1)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C17H24FNO3S/c1-13(10-17(2,3)15-7-5-4-6-8-15)19-11-14(9-16(19)20)12-23(18,21)22/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | GZVQGTSVHZRFBT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |