C14H15BrFNO5S — CID 168675007
(2S)-3-(2-bromophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid (PubChem CID 168675007) has the molecular formula C14H15BrFNO5S and a molecular weight of 408.25 g/mol. Its IUPAC name is (2S)-3-(2-bromophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid.
| Compound Name | (2S)-3-(2-bromophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 168675007 |
| Molecular Formula | C14H15BrFNO5S |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | (2S)-3-(2-bromophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1Br)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C14H15BrFNO5S/c15-11-4-2-1-3-10(11)6-12(14(19)20)17-7-9(5-13(17)18)8-23(16,21)22/h1-4,9,12H,5-8H2,(H,19,20)/t9?,12-/m0/s1 |
| InChIKey | VCTWMRQMZDFSKG-ACGXKRRESA-N |
| XLogP | 1.59 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |