C14H15ClFNO5S — CID 168674932
3-(4-chlorophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid (PubChem CID 168674932) has the molecular formula C14H15ClFNO5S and a molecular weight of 363.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 168674932 |
| Molecular Formula | C14H15ClFNO5S |
| Molecular Weight | 363.79 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C14H15ClFNO5S/c15-11-3-1-9(2-4-11)5-12(14(19)20)17-7-10(6-13(17)18)8-23(16,21)22/h1-4,10,12H,5-8H2,(H,19,20) |
| InChIKey | FZHXEPAGKKJDCG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |