C11H19FN2O5S — CID 168674969
6-amino-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanoic acid (PubChem CID 168674969) has the molecular formula C11H19FN2O5S and a molecular weight of 310.35 g/mol. Its IUPAC name is 6-amino-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-amino-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 168674969 |
| Molecular Formula | C11H19FN2O5S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-amino-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanoic acid |
| SMILES | NCCCCC(C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H19FN2O5S/c12-20(18,19)7-8-5-10(15)14(6-8)9(11(16)17)3-1-2-4-13/h8-9H,1-7,13H2,(H,16,17) |
| InChIKey | JVOJWBULUSVNPW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|