C11H19FN4O5S — CID 168674989
(2S)-5-(diaminomethylideneamino)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pentanoic acid (PubChem CID 168674989) has the molecular formula C11H19FN4O5S and a molecular weight of 338.36 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 168674989 |
| Molecular Formula | C11H19FN4O5S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H19FN4O5S/c12-22(20,21)6-7-4-9(17)16(5-7)8(10(18)19)2-1-3-15-11(13)14/h7-8H,1-6H2,(H,18,19)(H4,13,14,15)/t7?,8-/m0/s1 |
| InChIKey | SANMWUPLTZAPEO-MQWKRIRWSA-N |
| XLogP | -1.36 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|