C11H16FNO7S — CID 168675018
(2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid (PubChem CID 168675018) has the molecular formula C11H16FNO7S and a molecular weight of 325.31 g/mol. Its IUPAC name is (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid.
| Compound Name | (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid |
|---|---|
| PubChem CID | 168675018 |
| Molecular Formula | C11H16FNO7S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid |
| SMILES | O=C(O)CCC[C@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H16FNO7S/c12-21(19,20)6-7-4-9(14)13(5-7)8(11(17)18)2-1-3-10(15)16/h7-8H,1-6H2,(H,15,16)(H,17,18)/t7?,8-/m1/s1 |
| InChIKey | DZNVUWDDXDRHJZ-BRFYHDHCSA-N |
| XLogP | -0.16 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |