C13H19NO6S — CID 168666180
(2R)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid (PubChem CID 168666180) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is (2R)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid.
| Compound Name | (2R)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid |
|---|---|
| PubChem CID | 168666180 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2R)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]hexanedioic acid |
| SMILES | CC(=O)SCC1CC(=O)N([C@H](CCCC(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C13H19NO6S/c1-8(15)21-7-9-5-11(16)14(6-9)10(13(19)20)3-2-4-12(17)18/h9-10H,2-7H2,1H3,(H,17,18)(H,19,20)/t9?,10-/m1/s1 |
| InChIKey | OXOFCJBTQFFQTO-QVDQXJPCSA-N |
| XLogP | 0.82 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|