C15H17F2NO2S — CID 168665911
S-[[1-[1-(2,4-difluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168665911) has the molecular formula C15H17F2NO2S and a molecular weight of 313.37 g/mol. Its IUPAC name is S-[[1-[1-(2,4-difluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[1-(2,4-difluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168665911 |
| Molecular Formula | C15H17F2NO2S |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | S-[[1-[1-(2,4-difluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(C(C)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H17F2NO2S/c1-9(13-4-3-12(16)6-14(13)17)18-7-11(5-15(18)20)8-21-10(2)19/h3-4,6,9,11H,5,7-8H2,1-2H3 |
| InChIKey | UQRKYHLRZHUNHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|