C17H23NO2S — CID 168665992
S-[[1-[1-(4-ethylphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168665992) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is S-[[1-[1-(4-ethylphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[1-(4-ethylphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168665992 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | S-[[1-[1-(4-ethylphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CCc1ccc(C(C)N2CC(CSC(C)=O)CC2=O)cc1 |
| InChI | InChI=1S/C17H23NO2S/c1-4-14-5-7-16(8-6-14)12(2)18-10-15(9-17(18)20)11-21-13(3)19/h5-8,12,15H,4,9-11H2,1-3H3 |
| InChIKey | NFWAUCWMNFCCDA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|