C15H20N4O — CID 168655595
4-(azidomethyl)-1-[1-(4-ethylphenyl)ethyl]pyrrolidin-2-one (PubChem CID 168655595) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[1-(4-ethylphenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[1-(4-ethylphenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168655595 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-(azidomethyl)-1-[1-(4-ethylphenyl)ethyl]pyrrolidin-2-one |
| SMILES | CCc1ccc(C(C)N2CC(CN=[N+]=[N-])CC2=O)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-3-12-4-6-14(7-5-12)11(2)19-10-13(8-15(19)20)9-17-18-16/h4-7,11,13H,3,8-10H2,1-2H3 |
| InChIKey | JYCHSICYGYDCIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|