C10H16N4O3 — CID 168655566
2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]pentanoic acid (PubChem CID 168655566) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]pentanoic acid.
| Compound Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 168655566 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C10H16N4O3/c1-2-3-8(10(16)17)14-6-7(4-9(14)15)5-12-13-11/h7-8H,2-6H2,1H3,(H,16,17) |
| InChIKey | GFNJAKPMRJELFQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|