C13H14ClF2NO — CID 168506566
4-(chloromethyl)-1-[1-(2,4-difluorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 168506566) has the molecular formula C13H14ClF2NO and a molecular weight of 273.71 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[1-(2,4-difluorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-[1-(2,4-difluorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506566 |
| Molecular Formula | C13H14ClF2NO |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(chloromethyl)-1-[1-(2,4-difluorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | CC(c1ccc(F)cc1F)N1CC(CCl)CC1=O |
| InChI | InChI=1S/C13H14ClF2NO/c1-8(11-3-2-10(15)5-12(11)16)17-7-9(6-14)4-13(17)18/h2-3,5,8-9H,4,6-7H2,1H3 |
| InChIKey | NEPMUYTUHJTDJP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|