C13H15F2NOS — CID 168669233
1-[1-(3,4-difluorophenyl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168669233) has the molecular formula C13H15F2NOS and a molecular weight of 271.33 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168669233 |
| Molecular Formula | C13H15F2NOS |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | CC(c1ccc(F)c(F)c1)N1CC(CS)CC1=O |
| InChI | InChI=1S/C13H15F2NOS/c1-8(10-2-3-11(14)12(15)5-10)16-6-9(7-18)4-13(16)17/h2-3,5,8-9,18H,4,6-7H2,1H3 |
| InChIKey | TXCNRCSZUUUXPE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|