C14H19NOS — CID 168707654
1-[1-(3,4-dimethylphenyl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168707654) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[1-(3,4-dimethylphenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168707654 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1ccc(C(C)N2CC(S)CC2=O)cc1C |
| InChI | InChI=1S/C14H19NOS/c1-9-4-5-12(6-10(9)2)11(3)15-8-13(17)7-14(15)16/h4-6,11,13,17H,7-8H2,1-3H3 |
| InChIKey | YZKVGANFMGDOML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|