C12H14BrNOS — CID 168707754
1-[(1S)-1-(4-bromophenyl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168707754) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromophenyl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[(1S)-1-(4-bromophenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168707754 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1-[(1S)-1-(4-bromophenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC(S)CC1=O |
| InChI | InChI=1S/C12H14BrNOS/c1-8(9-2-4-10(13)5-3-9)14-7-11(16)6-12(14)15/h2-5,8,11,16H,6-7H2,1H3/t8-,11?/m0/s1 |
| InChIKey | CXKCYMFZGYRBGM-YMNIQAILSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|