C13H15NO4 — CID 168690179
1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168690179) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168690179 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | CC(c1ccc(O)cc1)N1CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C13H15NO4/c1-8(9-2-4-11(15)5-3-9)14-7-10(13(17)18)6-12(14)16/h2-5,8,10,15H,6-7H2,1H3,(H,17,18) |
| InChIKey | NXBJZRMAGWUVMA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |